Inquiry Basket
Meta-iodoHoechst 33258 | 158013-42-4
| Catelog Number | A19-0052 |
| Category | DNA Stains |
| Molecular Formula | C25H23IN6 |
| Molecular Weight | 534.39 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| A19-0052 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
Meta-iodoHoechst 33258, an iodinated DNA-binding bibenzimidazole, is a cell dye for DNA quantitation which sensitizes DNA and cells to UVA.
Chemical Information |
|
|---|---|
| Synonyms | 2'-(3-Iodophenyl)-5-(4-methyl-1-piperazinyl)-2,5'-BI-benzimidazole |
| Shelf Life | 2 years |
| IUPAC Name | 2-(3-iodophenyl)-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole |
| Canonical SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC(=CC=C6)I |
| InChI | InChI=1S/C25H23IN6/c1-31-9-11-32(12-10-31)19-6-8-21-23(15-19)30-25(28-21)17-5-7-20-22(14-17)29-24(27-20)16-3-2-4-18(26)13-16/h2-8,13-15H,9-12H2,1H3,(H,27,29)(H,28,30) |
| InChI Key | ZEXOKHKEQNNOBG-UHFFFAOYSA-N |
| Density | 1.587±0.06 g/cm3 |
| Appearance | Solid Powder |
Product Specification |
|
|---|---|
| Storage | Store at -20°C |
Computed Properties | |
|---|---|
| XLogP3 | 5 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 534.10289 g/mol |
| Monoisotopic Mass | 534.10289 g/mol |
| Topological Polar Surface Area | 63.8Ų |
| Heavy Atom Count | 32 |
| Formal Charge | 0 |
| Complexity | 642 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
