Inquiry Basket
DAPI dilactate | 28718-91-4
| Catalog Number | A19-0034 |
| Category | DNA Stains |
| Molecular Formula | C22H27N5O6 |
| Molecular Weight | 457.48 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| A19-0034 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
DAPI dilactate is a very sensitive dye used to detect single nucleic acid molecules.
Chemical Information |
|
|---|---|
| Synonyms | DAPI, dilactate [4',6-DiaMidino-2-phenylindole, dilactate]; 2-(4-carbamimidoylphenyl)-1H-indole-6-carboximidamide;2-hydroxypropanoic acid; 2-Hydroxypropanoic acid--2-(4-carbamimidoylphenyl)-1H-indole-6-carboximidamide (1/1) |
| IUPAC Name | 2-(4-carbamimidoylphenyl)-1H-indole-6-carboximidamide;2-hydroxypropanoic acid |
| Canonical SMILES | CC(C(=O)O)O.C1=CC(=CC=C1C2=CC3=C(N2)C=C(C=C3)C(=N)N)C(=N)N |
| InChI | InChI=1S/C16H15N5.C3H6O3/c17-15(18)10-3-1-9(2-4-10)13-7-11-5-6-12(16(19)20)8-14(11)21-13;1-2(4)3(5)6/h1-8,21H,(H3,17,18)(H3,19,20);2,4H,1H3,(H,5,6) |
| InChI Key | LCAUPANIXBMNIA-UHFFFAOYSA-N |
- Product Specification
| Excitation | 348 nm |
| Emission | 457 nm |
Computed Properties | |
|---|---|
| Hydrogen Bond Donor Count | 7 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 367.16443955 g/mol |
| Monoisotopic Mass | 367.16443955 g/mol |
| Topological Polar Surface Area | 173Ų |
| Heavy Atom Count | 27 |
| Formal Charge | 0 |
| Complexity | 472 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 2 |
| Compound Is Canonicalized | Yes |
Patents
| Publication Number | Title | Priority Date |
|---|---|---|
| US-2017299482-A1 | Counterstains for a biological sample | 2016-04-18 |
| US-10718694-B2 | Counterstains for a biological sample | 2016-04-18 |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
