Inquiry Basket
N-Boc-N-bis(PEG3-azide) | 1258939-38-6
| Catalog Number | R14-0094 |
| Category | Azides |
| Molecular Formula | C₂₁H₄₁N₇O₈ |
| Molecular Weight | 519.59 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| R14-0094 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
N-Boc-N-bis(PEG3-azide) is a polyethylene glycol (PEG)-based PROTAC linker. N-Boc-N-bis(PEG3-azide) can be used in the synthesis of a series of PROTACs.
Chemical Information |
|
|---|---|
| Synonyms | tert-butyl N,N-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]carbamate; tert-butyl bis(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl)carbamate |
| Purity | 98% |
| IUPAC Name | tert-butyl N,N-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]carbamate |
| Canonical SMILES | CC(C)(C)OC(=O)N(CCOCCOCCOCCN=[N+]=[N-])CCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C21H41N7O8/c1-21(2,3)36-20(29)28(6-10-32-14-18-34-16-12-30-8-4-24-26-22)7-11-33-15-19-35-17-13-31-9-5-25-27-23/h4-19H2,1-3H3 |
| InChI Key | QFOPRIUYDMJUNP-UHFFFAOYSA-N |
- Product Specification
| Storage | Please store the product under the recommended conditions in the Certificate of Analysis. |
Computed Properties | |
|---|---|
| XLogP3 | 2 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 12 |
| Rotatable Bond Count | 26 |
| Exact Mass | 519.30166129 g/mol |
| Monoisotopic Mass | 519.30166129 g/mol |
| Topological Polar Surface Area | 114Ų |
| Heavy Atom Count | 36 |
| Formal Charge | 0 |
| Complexity | 598 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Patents
| Publication Number | Title | Priority Date |
|---|---|---|
| EP-3440463-A1 | Intra-droplet surface engineering to capture a molecular target | 2016-04-05 |
| US-2019113509-A1 | Intra-droplet surface engineering to capture a molecular target | 2016-04-05 |
| WO-2017174610-A1 | Intra-droplet surface engineering to capture a molecular target | 2016-04-05 |
| EP-3440463-B1 | Intra-droplet surface engineering to capture a molecular target | 2016-04-05 |
| EP-3736572-A1 | Intra-droplet surface engineering to capture a molecular target | 2016-04-05 |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
