Inquiry Basket
Azido-PEG4-PFP ester | 1353012-00-6
| Catalog Number | R14-0297 |
| Category | Azides |
| Molecular Formula | C17H20F5N3O6 |
| Molecular Weight | 457.4 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| R14-0297 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
Azido-PEG4-PFP ester is a versatile chemical compound widely used in the biomedicine field. This ester derivative is utilized for the modification and functionalization of biomolecules, such as peptides and proteins. Its azido group allows for further conjugation or attachment to various drugs, biomaterials, or surfaces. This enables targeted drug delivery, protein labeling, and immunoassays for disease diagnostics and therapeutics.
Chemical Information |
|
|---|---|
| Synonyms | perfluorophenyl 1-azido-3,6,9,12-tetraoxapentadecan-15-oate |
| Purity | ≥98% |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| Canonical SMILES | C(COCCOCCOCCOCCN=[N+]=[N-])C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F |
| InChI | InChI=1S/C17H20F5N3O6/c18-12-13(19)15(21)17(16(22)14(12)20)31-11(26)1-3-27-5-7-29-9-10-30-8-6-28-4-2-24-25-23/h1-10H2 |
| InChI Key | QSIFGTAWLLFXPY-UHFFFAOYSA-N |
| Solubility | DMSO, DCM, DMF |
| Appearance | Soild powder |
- Product Specification
| Storage | -20 °C |
Computed Properties | |
|---|---|
| XLogP3 | 2.4 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 13 |
| Rotatable Bond Count | 17 |
| Exact Mass | 457.12722618 g/mol |
| Monoisotopic Mass | 457.12722618 g/mol |
| Topological Polar Surface Area | 77.6Ų |
| Heavy Atom Count | 31 |
| Formal Charge | 0 |
| Complexity | 544 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Patents
| Publication Number | Title | Priority Date |
|---|---|---|
| WO-2022150726-A1 | Hypoimmunogenic biotherapeutics | 2021-01-11 |
| WO-2022150721-A1 | Bifunctional folate receptor binding compounds | 2021-01-08 |
| EP-4087584-A2 | Cell surface receptor binding compounds and conjugates | 2020-01-10 |
| JP-2018127496-A | XTEN conjugate composition and method for producing the same | 2012-02-27 |
| JP-2018130123-A | XTEN conjugate composition and method for producing the same | 2012-02-27 |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
