* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Product Introduction
Azido-PEG1-NHS ester is a PEG derivative containing an azide group and an NHS ester. The hydrophilic PEG spacer increases solubility in aqueous media. The azide group can react with alkyne, BCN, and DBCO via Click Chemistry to yield a stable triazole linkage. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules.
Chemical Information
Product Specification
Computed Properties
Patents
| Related CAS |
1108750-59-9 (polymer)
|
| Synonyms |
N3-PEG1-CH2CH2COONHS; Propanoic acid, 3-(2-azidoethoxy)-, 2,5-dioxo-1-pyrrolidinyl ester; 1-{[3-(2-Azidoethoxy)propanoyl]oxy}-2,5-pyrrolidinedione; 2,5-Pyrrolidinedione, 1-[3-(2-azidoethoxy)-1-oxopropoxy]- |
| Purity |
≥95% |
| IUPAC Name |
(2,5-dioxopyrrolidin-1-yl) 3-(2-azidoethoxy)propanoate |
| Canonical SMILES |
C1CC(=O)N(C1=O)OC(=O)CCOCCN=[N+]=[N-] |
| InChI |
InChI=1S/C9H12N4O5/c10-12-11-4-6-17-5-3-9(16)18-13-7(14)1-2-8(13)15/h1-6H2 |
| InChIKey |
MGKGKSFTIINDPY-UHFFFAOYSA-N |
| Solubility |
Soluble in DCM, DMF, DMSO |
| Appearance |
Pale Yellow Oily Liquid |
| XLogP3 |
-0.1 |
| Hydrogen Bond Donor Count |
0 |
| Hydrogen Bond Acceptor Count |
7 |
| Rotatable Bond Count |
8 |
| Exact Mass |
256.08076950 g/mol |
| Monoisotopic Mass |
256.08076950 g/mol |
| Topological Polar Surface Area |
87.3Ų |
| Heavy Atom Count |
18 |
| Formal Charge |
0 |
| Complexity |
374 |
| Isotope Atom Count |
0 |
| Defined Atom Stereocenter Count |
0 |
| Undefined Atom Stereocenter Count |
0 |
| Defined Bond Stereocenter Count |
0 |
| Undefined Bond Stereocenter Count |
0 |
| Covalently-Bonded Unit Count |
1 |
| Compound Is Canonicalized |
Yes |
| Publication Number |
Title |
Priority Date |
| US-2021169896-A1 |
A cross-linked pyrrolobenzodiazepine dimer (pbd) derivative and its conjugates |
2018-07-05 |
| US-2019151462-A1 |
Cleavable conjugates of tlr7/8 agonist compounds, methods for preparation, and uses thereof |
2017-11-14 |
| US-10722591-B2 |
Cleavable conjugates of TLR7/8 agonist compounds, methods for preparation, and uses thereof |
2017-11-14 |
| US-2020282075-A1 |
Albumin-modified nanoparticles carrying a targeting ligand |
2017-09-07 |
| US-2020069814-A1 |
Conjugation of a cytotoxic drug with bis-linkage |
2017-04-06 |
![{[Name]}](https://resource.bocsci.com/structure/1835759-68-6.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/98924-81-3.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/361154-30-5.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/%28amino-peg10%29-tri-%28azide-peg10-ethoxymethyl%29-methanehclsalt.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/653600-56-7.gif?v=2025011501)
![{[Name]}](/probes/images/structure-default.jpg?v=2025011501)
