* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Product Introduction
Fluorescein-PEG6-Amine is a fluorescein dye with excitation/emmission maximum 494/517 nm containing a free amine group, which can be reactive with cabroxylic acid, activated NHS ester, carbonyl (ketone, aldehyde) etc. The hydophilic PEG spacer increases solubility in aqueous media and reduces steric hindrance during binding.
Chemical Information
Product Specification
Computed Properties
| Purity |
98% |
| IUPAC Name |
1-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)thiourea |
| Canonical SMILES |
C1=CC2=C(C=C1NC(=S)NCCOCCOCCOCCOCCOCCOCCN)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
| InChI |
InChI=1S/C35H43N3O11S/c36-7-9-42-11-13-44-15-17-46-19-20-47-18-16-45-14-12-43-10-8-37-34(50)38-24-1-4-28-27(21-24)33(41)49-35(28)29-5-2-25(39)22-31(29)48-32-23-26(40)3-6-30(32)35/h1-6,21-23,39-40H,7-20,36H2,(H2,37,38,50) |
| InChIKey |
DRTOXEJBNKKBSY-UHFFFAOYSA-N |
| Excitation |
494 |
| Emission |
517 |
| Storage |
-20 °C |
| XLogP3 |
1.2 |
| Hydrogen Bond Donor Count |
5 |
| Hydrogen Bond Acceptor Count |
13 |
| Rotatable Bond Count |
21 |
| Exact Mass |
713.26183037 g/mol |
| Monoisotopic Mass |
713.26183037 g/mol |
| Topological Polar Surface Area |
214Ų |
| Heavy Atom Count |
50 |
| Formal Charge |
0 |
| Complexity |
1000 |
| Isotope Atom Count |
0 |
| Defined Atom Stereocenter Count |
0 |
| Undefined Atom Stereocenter Count |
0 |
| Defined Bond Stereocenter Count |
0 |
| Undefined Bond Stereocenter Count |
0 |
| Covalently-Bonded Unit Count |
1 |
| Compound Is Canonicalized |
Yes |