* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Product Introduction
FAM maleimide, 6-isomer is a fluorescent dye widely used in the biomedical industry. It conjugates to thiol groups of biomolecules, allowing visualization and tracking within cells and tissues. It is commonly employed in protein labeling, imaging, and drug delivery studies, enabling the investigation and treatment of various diseases including cancer, neurodegenerative disorders, and infectious diseases.
Chemical Information
Product Specification
Computed Properties
Patents
| Purity |
NMR 1H, HPLC-MS (95%) |
| IUPAC Name |
N-[2-(2,5-dioxopyrrol-1-yl)ethyl]-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| Canonical SMILES |
C1=CC2=C(C=C1C(=O)NCCN3C(=O)C=CC3=O)C4(C5=C(C=C(C=C5)O)OC6=C4C=CC(=C6)O)OC2=O |
| InChI |
InChI=1S/C27H18N2O8/c30-15-2-5-18-21(12-15)36-22-13-16(31)3-6-19(22)27(18)20-11-14(1-4-17(20)26(35)37-27)25(34)28-9-10-29-23(32)7-8-24(29)33/h1-8,11-13,30-31H,9-10H2,(H,28,34) |
| InChIKey |
NGRZJKDBLCDKLG-UHFFFAOYSA-N |
| Solubility |
good in DMSO, DMF |
| Appearance |
yellow solid |
| Storage |
24 months after receival at -20°C in the dark. Transportation: at room temperature for up to 3 weeks. Avoid prolonged exposure to light. |
| XLogP3 |
2 |
| Hydrogen Bond Donor Count |
3 |
| Hydrogen Bond Acceptor Count |
8 |
| Rotatable Bond Count |
4 |
| Exact Mass |
498.10631554 g/mol |
| Monoisotopic Mass |
498.10631554 g/mol |
| Topological Polar Surface Area |
143Ų |
| Heavy Atom Count |
37 |
| Formal Charge |
0 |
| Complexity |
968 |
| Isotope Atom Count |
0 |
| Defined Atom Stereocenter Count |
0 |
| Undefined Atom Stereocenter Count |
0 |
| Defined Bond Stereocenter Count |
0 |
| Undefined Bond Stereocenter Count |
0 |
| Covalently-Bonded Unit Count |
1 |
| Compound Is Canonicalized |
Yes |
| Publication Number |
Title |
Priority Date |
| US-2019227066-A1 |
Compositions and methods for detecting cancer cells in a tissue sample |
2016-08-22 |
| WO-2018039282-A1 |
Compositions and methods for detecting cancer cells in a tissue sample |
2016-08-22 |
| US-2018036312-A1 |
Novel Scaffolds for Intracellular Compound Delivery for the Detection of Cancer Cells |
2016-08-02 |
| US-2018209986-A1 |
Compositions and methods for detecting cancer cells in a tissue sample |
2016-08-02 |
| WO-2018026538-A1 |
Novel scaffolds for intracellular compound delivery for the detection of cancer cells |
2016-08-02 |
![{[Name]}](https://resource.bocsci.com/structure/3301-79-9.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/3326-34-9.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/76-54-0.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/3%27-%286-fluorescein%29-cpg.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/3%27-6-fluorescein-serinol-cpg.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/92557-80-7.gif?v=2025011501)
