* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
    
                Product Introduction
                 Many natural and synthetic molecules contain aldehyde or ketone carbonyl groups. These carbonyls react with hydrazides with the formation of hydrazones. The reaction is spontaneous at pH values around neutral, and the resulting hydrazones are very stable.Compounds containing 1,2-diol function, like sugars, can be oxidized with sodium periodate with the formation of carbonyl compounds for the subsequent modification with hydrazides. This is an efficient method for the labeling of glycoproteins (like antibodies), and polysaccharides.
            
                
                        Chemical Information
 
                        Product Specification
 
                        Computed Properties
 
                
                        
                            
                                
                                        
                                            | Synonyms | 
                                            [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]azanium | 
                                        
                                        
                                            | Purity | 
                                            NMR 1H, HPLC-MS (95%) | 
                                        
                                        
                                            | IUPAC Name | 
                                            [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]azanium | 
                                        
                                        
                                            | Canonical SMILES | 
                                            C1=CC2=C(C=C1C(=O)N[NH3+])C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O | 
                                        
                                        
                                            | InChI | 
                                            InChI=1S/C21H14N2O6/c22-23-19(26)10-1-4-14-13(7-10)20(27)29-21(14)15-5-2-11(24)8-17(15)28-18-9-12(25)3-6-16(18)21/h1-9,24-25H,22H2,(H,23,26)/p+1 | 
                                        
                                        
                                            | InChIKey | 
                                            ZJLTXRWYPNRWBS-UHFFFAOYSA-O | 
                                        
                                        
                                            | Solubility | 
                                            good in ethanol, DMF, DMSO | 
                                        
                                        
                                            | Appearance | 
                                            yellow solid | 
                                        
                                
                            
                         
                        
                            
                                
                                        
                                            | ε, L⋅mol-1⋅cm-1 | 
                                            75000 | 
                                        
                                        
                                            | Fluorescence Quantum Yield | 
                                            0.9 | 
                                        
                                        
                                            | Excitation | 
                                            494 | 
                                        
                                        
                                            | Emission | 
                                            520 | 
                                        
                                        
                                            | Storage | 
                                            24 months after receival at -20°C in the dark. Transportation: at room temperature for up to 3 weeks. Avoid prolonged exposure to light. Desiccate. | 
                                        
                                
                            
                         
                        
                            
                                
                                        
                                            | XLogP3 | 
                                            2 | 
                                        
                                        
                                            | Hydrogen Bond Donor Count | 
                                            4 | 
                                        
                                        
                                            | Hydrogen Bond Acceptor Count | 
                                            6 | 
                                        
                                        
                                            | Rotatable Bond Count | 
                                            1 | 
                                        
                                        
                                            | Exact Mass | 
                                            391.09301120 g/mol | 
                                        
                                        
                                            | Monoisotopic Mass | 
                                            391.09301120 g/mol | 
                                        
                                        
                                            | Topological Polar Surface Area | 
                                            133Ų | 
                                        
                                        
                                            | Heavy Atom Count | 
                                            29 | 
                                        
                                        
                                            | Formal Charge | 
                                            1 | 
                                        
                                        
                                            | Complexity | 
                                            660 | 
                                        
                                        
                                            | Isotope Atom Count | 
                                            0 | 
                                        
                                        
                                            | Defined Atom Stereocenter Count | 
                                            0 | 
                                        
                                        
                                            | Undefined Atom Stereocenter Count | 
                                            0 | 
                                        
                                        
                                            | Defined Bond Stereocenter Count | 
                                            0 | 
                                        
                                        
                                            | Undefined Bond Stereocenter Count | 
                                            0 | 
                                        
                                        
                                            | Covalently-Bonded Unit Count | 
                                            1 | 
                                        
                                        
                                            | Compound Is Canonicalized | 
                                            Yes |