Inquiry Basket
Propargyl-PEG6-acid | 1951438-84-8
| Catalog Number | R01-0216 |
| Category | Alkynes |
| Molecular Formula | C16H28O8 |
| Molecular Weight | 348.39 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| R01-0216 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Chemical Information |
|
|---|---|
| Synonyms | Propyne-PEG5-CH2CH2COOH; Alkyne-PEG6-COOH; Propargyl-PEG6-COOH; Propargyl-PEG5-CH2CH2COOH; 4,7,10,13,16,19-Hexaoxadocos-21-yn-1-oic acid; 4,7,10,13,16,19-Hexaoxadocos-21-ynoic acid |
| Purity | >98.0% |
| Shelf Life | ≥ 2 years |
| IUPAC Name | 3-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| Canonical SMILES | C#CCOCCOCCOCCOCCOCCOCCC(=O)O |
| InChI | InChI=1S/C16H28O8/c1-2-4-19-6-8-21-10-12-23-14-15-24-13-11-22-9-7-20-5-3-16(17)18/h1H,3-15H2,(H,17,18) |
| InChI Key | XRSJYQQOJNYUDV-UHFFFAOYSA-N |
| Solubility | Soluble in DMSO, Water |
| Density | 1.126±0.06 g/cm3 (Predicted) |
| Appearance | Pale Yellow or Colorless Oily Liquid |
| Boiling Point | 462.8±45.0 °C at 760 mmHg |
| Vapor Pressure | 0.0±2.5 mmHg at 25°C |
| LogP | -1.52 |
- Product Specification
| Storage | Store at 2-8°C |
Computed Properties | |
|---|---|
| XLogP3 | -1 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 19 |
| Exact Mass | 348.17841785 g/mol |
| Monoisotopic Mass | 348.17841785 g/mol |
| Topological Polar Surface Area | 92.7Ų |
| Heavy Atom Count | 24 |
| Formal Charge | 0 |
| Complexity | 325 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Patents
| Publication Number | Title | Priority Date |
|---|---|---|
| EP-3430033-A1 | Insulin-incretin conjugates | 2016-03-18 |
| US-2019175744-A1 | Insulin-incretin conjugates | 2016-03-18 |
| WO-2017160669-A1 | Insulin-incretin conjugates | 2016-03-18 |
| WO-2012006475-A1 | Compounds and methods for inhibiting phosphate transport | 2010-07-07 |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
