* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Product Introduction
Palmitic acid alkyne is a form of palmitic acid with an ω-terminal alkyne. The terminal alkyne group can be used in linking reactions, known as click chemistry; this chemistry is characterized by high dependability and specificity of the azide-alkyne bioconjugation reactions. Alkynyl palmitic acid can be used for isolating palmitoylated proteins.
Chemical Information
Product Specification
Computed Properties
Literatures
Patents
| Synonyms |
Palmitic acid (15-yne); Alkynyl Palmitic Acid; 15-Hexadecyn-1-oic acid |
| Purity |
>99% |
| Shelf Life |
1 Year |
| IUPAC Name |
hexadec-15-ynoic acid |
| Canonical SMILES |
C#CCCCCCCCCCCCCCC(=O)O |
| InChI |
InChI=1S/C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h1H,3-15H2,(H,17,18) |
| InChIKey |
PUZGUNYANHPRKM-UHFFFAOYSA-N |
| Solubility |
In DMSO: 100 mg/mL (396.21 mM; Need ultrasonic) |
| Appearance |
Powder |
| Hydrogen Bond Donor Count |
1 |
| Hydrogen Bond Acceptor Count |
2 |
| Rotatable Bond Count |
13 |
| Exact Mass |
252.208930132 g/mol |
| Monoisotopic Mass |
252.208930132 g/mol |
| Topological Polar Surface Area |
37.3Ų |
| Heavy Atom Count |
18 |
| Formal Charge |
0 |
| Complexity |
237 |
| Isotope Atom Count |
0 |
| Defined Atom Stereocenter Count |
0 |
| Undefined Atom Stereocenter Count |
0 |
| Defined Bond Stereocenter Count |
0 |
| Undefined Bond Stereocenter Count |
0 |
| Covalently-Bonded Unit Count |
1 |
| Compound Is Canonicalized |
Yes |
| PMID |
Publication Date |
Title |
Journal |
| 11556821 |
2001-09-15 |
Expressed CYP4A4 metabolism of prostaglandin E(1) and arachidonic acid |
Archives of biochemistry and biophysics |
| 2997155 |
1985-10-25 |
Leukotriene B4 omega-hydroxylase in human polymorphonuclear leukocytes. Suicidal inactivation by acetylenic fatty acids |
The Journal of biological chemistry |
| Publication Number |
Title |
Priority Date |
| BR-112021011050-A2 |
PEPTIDE LINK |
2018-12-11 |
| US-2022048968-A1 |
Insulin conjugates |
2018-12-11 |
| US-2019389885-A1 |
Complex and process for preparing complex |
2018-06-25 |
| US-11034706-B2 |
Complex and process for preparing complex |
2018-06-25 |
| JP-7151210-B2 |
Complex and method for producing complex |
2018-06-25 |
![{[Name]}](https://resource.bocsci.com/structure/2112737-25-2.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/1421676-62-1.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/2055105-25-2.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/2055022-22-3.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/1174157-65-3.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/2055022-18-7.gif?v=2025011501)
