* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Product Introduction
Propargyl-PEG13-acid is a heterobifunctional PEG liker containing a propargyl group and a carboxylic acid. The propargyl group can react with azide in various biomolecules via click chemistry, and the carboxylic acid can be reacted with amino groups in the presence of activators.
Chemical Information
Product Specification
Computed Properties
Patents
| Synonyms |
Propargyl-PEG14-acid;Propyne-PEG12-CH2CH2COOH; Propyne-PEG12-propionic acid |
| Purity |
>97% |
| IUPAC Name |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| Canonical SMILES |
C#CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
| InChI |
InChI=1S/C30H56O15/c1-2-4-33-6-8-35-10-12-37-14-16-39-18-20-41-22-24-43-26-28-45-29-27-44-25-23-42-21-19-40-17-15-38-13-11-36-9-7-34-5-3-30(31)32/h1H,3-29H2,(H,31,32) |
| InChIKey |
ZFFDQVFGKMOUSS-UHFFFAOYSA-N |
| Solubility |
Water, DMSO, DCM, DMF |
| XLogP3 |
-2.1 |
| Hydrogen Bond Donor Count |
1 |
| Hydrogen Bond Acceptor Count |
15 |
| Rotatable Bond Count |
40 |
| Exact Mass |
656.36192108 g/mol |
| Monoisotopic Mass |
656.36192108 g/mol |
| Topological Polar Surface Area |
157Ų |
| Heavy Atom Count |
45 |
| Formal Charge |
0 |
| Complexity |
632 |
| Isotope Atom Count |
0 |
| Defined Atom Stereocenter Count |
0 |
| Undefined Atom Stereocenter Count |
0 |
| Defined Bond Stereocenter Count |
0 |
| Undefined Bond Stereocenter Count |
0 |
| Covalently-Bonded Unit Count |
1 |
| Compound Is Canonicalized |
Yes |
| Publication Number |
Title |
Priority Date |
| EP-3430033-A1 |
Insulin-incretin conjugates |
2016-03-18 |
| US-2019175744-A1 |
Insulin-incretin conjugates |
2016-03-18 |
| WO-2017160669-A1 |
Insulin-incretin conjugates |
2016-03-18 |
![{[Name]}](https://resource.bocsci.com/structure/82909-47-5.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/2170240-99-8.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/1351556-81-4.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/34993-56-1.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/1817735-37-7.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/99208-90-9.gif?v=2025011501)
