Inquiry Basket
Para-iodoHoechst 33258 | 158013-43-5
| Catalog Number | A19-0053 |
| Category | DNA Stains |
| Molecular Formula | C25H23IN6 |
| Molecular Weight | 534.39 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| A19-0053 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
Para-iodoHoechst 33258, an iodinated DNA-binding bibenzimidazole, is a cell dye for DNA quantitation which sensitizes DNA and cells to UVA.
Chemical Information |
|
|---|---|
| Synonyms | 2-(4-iodophenyl)-6-[6-(4-methylpiperazin-1-yl)-1-H-benzimidazol-2-yl]-1-H-benzimidazole |
| Shelf Life | 2 years |
| IUPAC Name | 2-(4-iodophenyl)-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole |
| Canonical SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC=C(C=C6)I |
| InChI | InChI=1S/C25H23IN6/c1-31-10-12-32(13-11-31)19-7-9-21-23(15-19)30-25(28-21)17-4-8-20-22(14-17)29-24(27-20)16-2-5-18(26)6-3-16/h2-9,14-15H,10-13H2,1H3,(H,27,29)(H,28,30) |
| InChI Key | WSBVZEKIZWIJQO-UHFFFAOYSA-N |
| Density | 1.587±0.06 g/cm3 |
| Appearance | Solid Powder |
- Product Specification
| Storage | Store at -20°C |
Computed Properties | |
|---|---|
| XLogP3 | 5 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 534.10289 g/mol |
| Monoisotopic Mass | 534.10289 g/mol |
| Topological Polar Surface Area | 63.8Ų |
| Heavy Atom Count | 32 |
| Formal Charge | 0 |
| Complexity | 634 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Patents
| Publication Number | Title | Priority Date |
|---|---|---|
| US-2006199955-A1 | Phosphonylated fluorescent dyes and conjugates | 2004-08-13 |
| US-2007172832-A1 | Phosphonate fluorescent dyes and conjugates | 2004-08-13 |
| US-2008207887-A1 | Phosphonylated fluorescent dyes and conjugates | 2004-08-13 |
| US-2010261903-A1 | Phosphonate fluorescent dyes and conjugates | 2004-08-13 |
| US-2012116079-A1 | Phosphonate fluorescent dyes and conjugates | 2004-08-13 |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
