Category: DNA Stains
Ortho-iodoHoechst 33258, an iodinated DNA-binding bibenzimidazole, is a cell dye for DNA quantitation which sensitizes DNA and cells to UVA.
Catelog Number: | A19-0051 |
Product Name: | Ortho-iodoHoechst 33258 |
CAS Number: | 158013-41-3 |
Molecular Formula: | C25H23IN6 |
Molecular Weight: | 534.39 |
Synonyms: | 2-(2-iodophenyl)-6-[6-(4-methylpiperazin-1-yl)-1-H-benzimidazol-2-yl]-1-H-benzimidazole |
Appearance: | Solid Powder |
Storage Conditions: | Store at -20°C |
InChI: | InChI=1S/C25H23IN6/c1-31-10-12-32(13-11-31)17-7-9-21-23(15-17)29-24(27-21)16-6-8-20-22(14-16)30-25(28-20)18-4-2-3-5-19(18)26/h2-9,14-15H,10-13H2,1H3,(H,27,29)(H,28,30) |
InChIKey: | UOHARKYRPCGBEI-UHFFFAOYSA-N |
CanonicalSMILES: | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC=CC=C6I |