* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Product Introduction
Coumarin 343 is a blue emitting fluorophore with an emission maximum around 480 nm. This dye forms a FRET pair with fluorescein, and can harvest blue light energy for the subsequent transfer to other fluorophores. The azide derivative can be conjugated with alkynes in a copper-catalyzed and copper-free Click chemistry reactions. The molecule contains a long aminohexanoyl linker that provides separation between the dye, and the azide function.
Chemical Information
Product Specification
Computed Properties
| Purity |
NMR 1H, HPLC-MS (95%) |
| IUPAC Name |
N-[6-(3-azidopropylamino)-6-oxohexyl]-4-oxo-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraene-5-carboxamide |
| Canonical SMILES |
C1CC2=C3C(=C4C(=C2)C=C(C(=O)O4)C(=O)NCCCCCC(=O)NCCCN=[N+]=[N-])CCCN3C1 |
| InChI |
InChI=1S/C25H32N6O4/c26-30-29-12-6-11-27-21(32)9-2-1-3-10-28-24(33)20-16-18-15-17-7-4-13-31-14-5-8-19(22(17)31)23(18)35-25(20)34/h15-16H,1-14H2,(H,27,32)(H,28,33) |
| InChIKey |
ZRKQCSLPBMELEA-UHFFFAOYSA-N |
| Solubility |
good in DMF, DMSO |
| Appearance |
yellow solid |
| ε, L⋅mol-1⋅cm-1 |
39000 |
| Fluorescence Quantum Yield |
0.63 |
| Excitation |
437 |
| Emission |
477 |
| Storage |
24 months after receival at -20°C in the dark. Transportation: at room temperature for up to 3 weeks. Avoid prolonged exposure to light. |
| XLogP3 |
4.4 |
| Hydrogen Bond Donor Count |
2 |
| Hydrogen Bond Acceptor Count |
7 |
| Rotatable Bond Count |
11 |
| Exact Mass |
480.24850352 g/mol |
| Monoisotopic Mass |
480.24850352 g/mol |
| Topological Polar Surface Area |
102Ų |
| Heavy Atom Count |
35 |
| Formal Charge |
0 |
| Complexity |
870 |
| Isotope Atom Count |
0 |
| Defined Atom Stereocenter Count |
0 |
| Undefined Atom Stereocenter Count |
0 |
| Defined Bond Stereocenter Count |
0 |
| Undefined Bond Stereocenter Count |
0 |
| Covalently-Bonded Unit Count |
1 |
| Compound Is Canonicalized |
Yes |