Inquiry Basket
2,5-Bis(4-biphenylyl)oxazole | 2083-09-2
| Catalog Number | A17-0005 |
| Category | Laser Dyes |
| Molecular Formula | C27H19NO |
| Molecular Weight | 373.455 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| A17-0005 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
2,5-Bis(4-biphenylyl)oxazole is a compound of immense biomedical significance and manifests extensive applications in pharmaceutical drug development and the exploration of diverse ailments. This compound could help identify and improve precise drug targets or diseases, driving major advances in biomedicine.
Chemical Information |
|
|---|---|
| Synonyms | 2,5-bis([1,1'-biphenyl]-4-yl)-oxazole |
| IUPAC Name | 2,5-bis(4-phenylphenyl)-1,3-oxazole |
| Canonical SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CN=C(O3)C4=CC=C(C=C4)C5=CC=CC=C5 |
| InChI | InChI=1S/C27H19NO/c1-3-7-20(8-4-1)22-11-15-24(16-12-22)26-19-28-27(29-26)25-17-13-23(14-18-25)21-9-5-2-6-10-21/h1-19H |
| InChI Key | DDZJGFHXUOWOSL-UHFFFAOYSA-N |
Computed Properties | |
|---|---|
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 373.146664230 g/mol |
| Monoisotopic Mass | 373.146664230 g/mol |
| Topological Polar Surface Area | 26Ų |
| Heavy Atom Count | 29 |
| Formal Charge | 0 |
| Complexity | 479 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Patents
| Publication Number | Title | Priority Date |
|---|---|---|
| US-2022363962-A1 | Uv or eb curable multifunctional tall oil (meth)acrylates | 2021-05-13 |
| WO-2022189998-A1 | Thermoplastic compositions | 2021-03-12 |
| WO-2022101763-A1 | Thermoplastic polycarbonate compositions and shaped articles thereof | 2020-11-10 |
| US-2022105001-A1 | Compositions and devices for containing medical fluids | 2020-10-02 |
| WO-2022010940-A1 | Polyhydroxyalkanoate-based compositions and articles made therefrom | 2020-07-07 |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
