1,4-Bis(5-phenyl-2-oxazolyl)benzene | 1806-34-4

Product Introduction

1,4-Bis(5-phenyl-2-oxazolyl)benzene is a highly versatile compound that is extensively employed within the realm of biomedicine. Renowned for its potential as a drug candidate for combating a myriad of ailments such as cancer and inflammation, this compound showcases exceptional pharmacological attributes due to its unparalleled molecular configuration. Its boundless potential enables it to serve as an indispensable instrument for the cutting-edge field of drug exploration and advancement, particularly within the biomedical industry.

Chemical Information
Synonyms	1,4-Bis(5-phenyloxazol-2-yl)benzene;2,2'-(1,4-phenylene)bis[5-phenyl-oxazole]; 2,2'-p-Phenylene-bis(5-phenyloxazole); POPOP
Purity	98.0%
Canonical SMILES	C1=CC=C(C=C1)C2=CN=C(O2)C3=CC=C(C=C3)C4=NC=C(O4)C5=CC=CC=C5
InChI	InChI=1S/C24H16N2O2/c1-3-7-17(8-4-1)21-15-25-23(27-21)19-11-13-20(14-12-19)24-26-16-22(28-24)18-9-5-2-6-10-18/h1-16H
InChI Key	MASVCBBIUQRUKL-UHFFFAOYSA-N