Inquiry Basket
TAMRA amine, 5-isomer | 2158336-48-0
| Catalog Number | F07-0020 |
| Category | TAMRA |
| Molecular Formula | C31H37ClN4O4 |
| Molecular Weight | 565.1 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| F07-0020 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
TAMRA amine, 5-isomer is a rhodamine dye with excitation/emission maximum 553/575 nm. The amine group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc.
Chemical Information |
|
|---|---|
| Synonyms | 5-((6-Aminohexyl)carbamoyl)-2-(3,6-bis(dimethylamino)xanthylium-9-yl)benzoate hydrochloride |
| Purity | 95% |
| IUPAC Name | 5-(6-aminohexylcarbamoyl)-2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate;hydrochloride |
| Canonical SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=C(C=C4)C(=O)NCCCCCCN)C(=O)[O-].Cl |
| InChI | InChI=1S/C31H36N4O4.ClH/c1-34(2)21-10-13-24-27(18-21)39-28-19-22(35(3)4)11-14-25(28)29(24)23-12-9-20(17-26(23)31(37)38)30(36)33-16-8-6-5-7-15-32;/h9-14,17-19H,5-8,15-16,32H2,1-4H3,(H-,33,36,37,38);1H |
| InChI Key | VPOLLACBGNYGIN-UHFFFAOYSA-N |
| Solubility | DMF, DMSO, alcohols |
- Product Specification
| Fluorescence Quantum Yield | 0.10 |
| Excitation | 541 |
| Emission | 567 |
| Storage | -20 °C |
Computed Properties | |
|---|---|
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 9 |
| Exact Mass | 564.2503334 g/mol |
| Monoisotopic Mass | 564.2503334 g/mol |
| Topological Polar Surface Area | 111Ų |
| Heavy Atom Count | 40 |
| Formal Charge | 0 |
| Complexity | 990 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 2 |
| Compound Is Canonicalized | Yes |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
