* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Product Introduction
Pyrene-PEG2-azide is a pyrene labeled PEG linker containing an azide group, which enables Click Chemistry labeling with any alkyne-bearing molecules and thus turns any molecule into pyrene-bearing probe. The hydrophilic PEG linker can increase solubility and facilitate attachment to biomolecules in aqueous solutions.
Chemical Information
Product Specification
Computed Properties
Patents
| Synonyms |
1-Pyrenecarboxylic acid-PEG2-azide; Pyrene azide 1; N-{2-[2-(2-azidoethoxy)ethoxy]ethyl}pyrene-1-carboxamide |
| Purity |
96% |
| IUPAC Name |
N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]pyrene-1-carboxamide |
| Canonical SMILES |
C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C(=O)NCCOCCOCCN=[N+]=[N-] |
| InChI |
InChI=1S/C23H22N4O3/c24-27-26-11-13-30-15-14-29-12-10-25-23(28)20-9-7-18-5-4-16-2-1-3-17-6-8-19(20)22(18)21(16)17/h1-9H,10-15H2,(H,25,28) |
| InChIKey |
CXNRBKHYGKLDHH-UHFFFAOYSA-N |
| Solubility |
DMSO, DMF, DCM |
| Fluorescence Quantum Yield |
1.00 |
| Excitation |
343; 326; 313 |
| Emission |
377; 397 |
| Storage |
-20 °C |
| XLogP3 |
4.9 |
| Hydrogen Bond Donor Count |
1 |
| Hydrogen Bond Acceptor Count |
5 |
| Rotatable Bond Count |
10 |
| Exact Mass |
402.16919058 g/mol |
| Monoisotopic Mass |
402.16919058 g/mol |
| Topological Polar Surface Area |
61.9Ų |
| Heavy Atom Count |
30 |
| Formal Charge |
0 |
| Complexity |
624 |
| Isotope Atom Count |
0 |
| Defined Atom Stereocenter Count |
0 |
| Undefined Atom Stereocenter Count |
0 |
| Defined Bond Stereocenter Count |
0 |
| Undefined Bond Stereocenter Count |
0 |
| Covalently-Bonded Unit Count |
1 |
| Compound Is Canonicalized |
Yes |
| Publication Number |
Title |
Priority Date |
| US-2021292804-A1 |
Recombinant flavin-adenine dinucleotide glucose dehydrogenase and uses thereof |
2017-08-02 |
| EP-3399967-A2 |
Selective killing of tumors of the hematopoietic and lymphoid tissues |
2016-01-05 |
| US-2019022032-A1 |
Selective killing of tumors of the hematopoietic and lymphoid tissues |
2016-01-05 |
| WO-2017120296-A2 |
Selective killing of tumors of the hematopoietic and lymphoid tissues |
2016-01-05 |
| US-10905658-B2 |
Methods and compositions for detecting hematopoietic and lymphoid tissue cancer cells |
2016-01-05 |
![{[Name]}](https://resource.bocsci.com/structure/1115084-83-7.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/132196-66-8.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/1807512-45-3.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/3443-45-6.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/1869968-64-8.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/1006061-57-9.gif?v=2025011501)
