Inquiry Basket
FDGlcU
| Catalog Number | A18-0088 |
| Category | Fluorescent Enzyme Substrates |
| Molecular Formula | C13H28O17 |
| Molecular Weight | 684.55 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| A18-0088 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
FDGlcU is a fluorogenic substrate for beta-glucuronidases.
Chemical Information |
|
|---|---|
| Synonyms | Fluorescein Di-β-D-Glucuronide |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[6'-[(2S,3R,4S,5S,6S)-6-carboxy-3,4,5-trihydroxyoxan-2-yl]oxy-3-oxo-5-[(2,3,4,5,6-pentafluorobenzoyl)amino]spiro[2-benzofuran-1,9'-xanthene]-3'-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Canonical SMILES | C1=CC2=C(C=C1NC(=O)C3=C(C(=C(C(=C3F)F)F)F)F)C(=O)OC24C5=C(C=C(C=C5)OC6C(C(C(C(O6)C(=O)O)O)O)O)OC7=C4C=CC(=C7)OC8C(C(C(C(O8)C(=O)O)O)O)O |
| InChI | InChI=1S/C39H28F5NO18/c40-20-19(21(41)23(43)24(44)22(20)42)33(52)45-10-1-4-14-13(7-10)36(57)63-39(14)15-5-2-11(58-37-29(50)25(46)27(48)31(61-37)34(53)54)8-17(15)60-18-9-12(3-6-16(18)39)59-38-30(51)26(47)28(49)32(62-38)35(55)56/h1-9,25-32,37-38,46-51H,(H,45,52)(H,53,54)(H,55,56)/t25-,26-,27-,28-,29+,30+,31-,32-,37+,38+/m0/s1 |
| InChI Key | FZYCODLHHHKEGD-JXWZXEQKSA-N |
| Appearance | Solid Powder |
Computed Properties | |
|---|---|
| XLogP3 | 1.6 |
| Hydrogen Bond Donor Count | 9 |
| Hydrogen Bond Acceptor Count | 23 |
| Rotatable Bond Count | 8 |
| Exact Mass | 893.12265385 g/mol |
| Monoisotopic Mass | 893.12265385 g/mol |
| Topological Polar Surface Area | 298Ų |
| Heavy Atom Count | 63 |
| Formal Charge | 0 |
| Complexity | 1650 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 10 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Patents
| Publication Number | Title | Priority Date |
|---|---|---|
| US-2008176225-A1 | Membrane bound reporter gene system | 2007-01-18 |
| EP-1337658-B1 | A method for the detection of viable microorganisms | 2000-11-09 |
| US-2005202523-A1 | Method for the detection of viable microorganisms | 2000-11-09 |
| US-2003003562-A1 | Lactobacillus beta-glucuronidase and DNA encoding the same | 2000-05-23 |
| US-6664097-B2 | Polynucleotide encoding a Lactobacillus gasseri beta-glucuronidase polypeptide | 2000-05-23 |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
