Inquiry Basket
BDY 650-X, SE | 235439-04-0
| Catelog Number | R01-0008 |
| Category | BODIPY |
| Molecular Formula | C33H32BF2N5O6 |
| Molecular Weight | 643.44 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| R01-0008 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
BDY 650-X, SE is a reagent that can be used as a fluorescent agent for the labeling of amines. It can also be used to create biosensor arrays on micro- and nano-structured surfaces.
Chemical Information |
|
|---|---|
| Synonyms | BDP 650/665 X NHS ester;(T-4)-[2-[4-[2-[2-[([2,2'-Bi-1H-pyrrol]-5-yl-κN1)methylene]-2H-pyrrol-5-yl-κN]ethenyl]phenoxy]-N-[6-[(2,5-dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]acetamidato]difluoroboron |
| Purity | ≥90% |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[2-[4-[(E)-2-[2,2-difluoro-12-(1H-pyrrol-2-yl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl]ethenyl]phenoxy]acetyl]amino]hexanoate |
| Canonical SMILES | F[B-]1(F)[N+]2=C(C=CC2=CC3=CC=C(C4=CC=CN4)N13)/C=C/C5=CC=C(OCC(NCCCCCC(ON6C(CCC6=O)=O)=O)=O)C=C5 |
| InChI | InChI=1S/C33H32BF2N5O6/c35-34(36)39-24(11-12-25(39)21-26-13-16-29(40(26)34)28-5-4-20-37-28)10-7-23-8-14-27(15-9-23)46-22-30(42)38-19-3-1-2-6-33(45)47-41-31(43)17-18-32(41)44/h4-5,7-16,20-21,37H,1-3,6,17-19,22H2,(H,38,42)/b10-7+ |
| InChI Key | CDXXFTJLAKSQSR-JXMROGBWSA-N |
| Solubility | Soluble to 64.34 mg/ml in DMSO. |
| Appearance | Solid |
Product Specification |
|
|---|---|
| ε, L⋅mol-1⋅cm-1 | 94000 |
| Fluorescence Quantum Yield | 0.52 |
| Excitation | 649 |
| Emission | 667 |
Computed Properties | |
|---|---|
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 14 |
| Exact Mass | 643.2413702 g/mol |
| Monoisotopic Mass | 643.2413702 g/mol |
| Topological Polar Surface Area | 126Ų |
| Heavy Atom Count | 47 |
| Formal Charge | 0 |
| Complexity | 1340 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Patents
| Publication Number | Title | Priority Date |
|---|---|---|
| WO-2020072491-A1 | Brevican-binding peptides for brain tumor imaging | 2018-10-01 |
| US-2016121002-A1 | Bioorthogonal Turn-on Probes | 2013-05-06 |
| US-2020188535-A1 | Bioorthogonal Turn-on Probes | 2013-05-06 |
| US-2016022817-A1 | Photoswitchable HDAC Inhibitors | 2013-03-13 |
| US-2019070295-A1 | Photoswitchable HDAC Inhibitors | 2013-03-13 |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
