* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Product Introduction
t-Boc-N-amido-PEG2-azide is a bifunctional polyethylene glycol linker featuring a tert-butyloxycarbonyl-protected amide and an azide terminus. Its amphiphilic structure facilitates solubility and compatibility in organic and aqueous media, making it ideal for conjugation strategies. The azide group enables selective biorthogonal click chemistry, commonly used for site-specific labeling and protein modification. This versatile reagent supports advancements in peptide synthesis, drug delivery research, and bioconjugation studies.
Chemical Information
Product Specification
Computed Properties
Patents
| Synonyms |
tert-butyl {2-[2-(2-azidoethoxy)ethoxy]ethyl}carbamate; Boc-NH-PEG(2)-N3 |
| Purity |
≥ 98% (HPLC) |
| IUPAC Name |
tert-butyl N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]carbamate |
| Canonical SMILES |
CC(C)(C)OC(=O)NCCOCCOCCN=[N+]=[N-] |
| InChI |
InChI=1S/C11H22N4O4/c1-11(2,3)19-10(16)13-4-6-17-8-9-18-7-5-14-15-12/h4-9H2,1-3H3,(H,13,16) |
| InChIKey |
MEZSEFQCLYODJG-UHFFFAOYSA-N |
| Appearance |
Light yellow oil |
| XLogP3 |
1.5 |
| Hydrogen Bond Donor Count |
1 |
| Hydrogen Bond Acceptor Count |
6 |
| Rotatable Bond Count |
11 |
| Exact Mass |
274.16410520 g/mol |
| Monoisotopic Mass |
274.16410520 g/mol |
| Topological Polar Surface Area |
71.2Ų |
| Heavy Atom Count |
19 |
| Formal Charge |
0 |
| Complexity |
298 |
| Isotope Atom Count |
0 |
| Defined Atom Stereocenter Count |
0 |
| Undefined Atom Stereocenter Count |
0 |
| Defined Bond Stereocenter Count |
0 |
| Undefined Bond Stereocenter Count |
0 |
| Covalently-Bonded Unit Count |
1 |
| Compound Is Canonicalized |
Yes |
| Publication Number |
Title |
Priority Date |
| JP-2023500377-A |
Radiolabeled targeting ligand |
2019-11-08 |
| US-2019192668-A1 |
Irak degraders and uses thereof |
2017-12-26 |
| WO-2019133531-A1 |
Irak degraders and uses thereof |
2017-12-26 |
| AU-2018396142-A1 |
IRAK degraders and uses thereof |
2017-12-26 |
| US-10874743-B2 |
IRAK degraders and uses thereof |
2017-12-26 |
![{[Name]}](/probes/images/structure-default.jpg?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/59559-06-7.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/361154-30-5.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/1835759-68-6.gif?v=2025011501)
![{[Name]}](https://resource.bocsci.com/structure/653600-56-7.gif?v=2025011501)
