Inquiry Basket
N-(Azido-PEG3)-PEG4-t-butyl ester
| Catalog Number | R14-0097 |
| Category | Azides |
| Molecular Formula | C23H46N4O9 |
| Molecular Weight | 522.6 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| R14-0097 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
Azide-PEG-CH2CO2H, MW 5,000 is a click chemistry PEG polymer, azide undergoes click chemistry with alkyne group, such as DBCO or BCN molecules. Carboxylic acid can conjugate with amine containing molecules such as protein, peptide in the presence of coupling reagent, HATU or EDC to form a stable amide bond.
Chemical Information |
|
|---|---|
| Purity | 98% |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| Canonical SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCNCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C23H46N4O9/c1-23(2,3)36-22(28)4-8-29-12-16-33-20-21-35-18-14-31-10-6-25-5-9-30-13-17-34-19-15-32-11-7-26-27-24/h25H,4-21H2,1-3H3 |
| InChI Key | LUXGMTDJUGRSOT-UHFFFAOYSA-N |
- Product Specification
| Storage | -20 °C |
Computed Properties | |
|---|---|
| XLogP3 | 0.5 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 12 |
| Rotatable Bond Count | 29 |
| Exact Mass | 522.32647906 g/mol |
| Monoisotopic Mass | 522.32647906 g/mol |
| Topological Polar Surface Area | 117Ų |
| Heavy Atom Count | 36 |
| Formal Charge | 0 |
| Complexity | 544 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
