* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
Product Introduction
Azido-PEG20-azide is a long chain, monodisperse PEG linker consisting of two azide groups. The hydrophilic PEG spacer increases solubility in aqueous media. The azide group is reactive with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage.
Chemical Information
Product Specification
Computed Properties
| Synonyms |
Azido-PEG20-Azide
BP-23132 |
| Purity |
98% |
| IUPAC Name |
1-azido-2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethane |
| Canonical SMILES |
C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])N=[N+]=[N-] |
| InChI |
InChI=1S/C42H84N6O20/c43-47-45-1-3-49-5-7-51-9-11-53-13-15-55-17-19-57-21-23-59-25-27-61-29-31-63-33-35-65-37-39-67-41-42-68-40-38-66-36-34-64-32-30-62-28-26-60-24-22-58-20-18-56-16-14-54-12-10-52-8-6-50-4-2-46-48-44/h1-42H2 |
| InChIKey |
JPXMBRZJDXMIAN-UHFFFAOYSA-N |
| XLogP3 |
-0.9 |
| Hydrogen Bond Donor Count |
0 |
| Hydrogen Bond Acceptor Count |
24 |
| Rotatable Bond Count |
63 |
| Exact Mass |
992.57403909 g/mol |
| Monoisotopic Mass |
992.57403909 g/mol |
| Topological Polar Surface Area |
213Ų |
| Heavy Atom Count |
68 |
| Formal Charge |
0 |
| Complexity |
968 |
| Isotope Atom Count |
0 |
| Defined Atom Stereocenter Count |
0 |
| Undefined Atom Stereocenter Count |
0 |
| Defined Bond Stereocenter Count |
0 |
| Undefined Bond Stereocenter Count |
0 |
| Covalently-Bonded Unit Count |
1 |
| Compound Is Canonicalized |
Yes |