Inquiry Basket
5-hexynoic NHS ester | 906564-59-8
| Catalog Number | R01-0002 |
| Category | NHS Esters |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| R01-0002 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Chemical Information |
|
|---|---|
| Synonyms | Alkyne NHS ester (hexynoic acid NHS ester);1-(5-Hexynoyloxy)-2,5-pyrrolidinedione; |
| Purity | ≥98% |
| Canonical SMILES | C#CCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H11NO4/c1-2-3-4-5-10(14)15-11-8(12)6-7-9(11)13/h1H,3-7H2 |
| InChI Key | CXSSWEBEHUYETJ-UHFFFAOYSA-N |
| Solubility | good in organic solvents (DMF, DMSO, DCM) |
| Appearance | Soild powder |
Computed Properties | |
|---|---|
| XLogP3 | 0.1 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 209.06880783 g/mol |
| Monoisotopic Mass | 209.06880783 g/mol |
| Topological Polar Surface Area | 63.7Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 323 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Patents
| Publication Number | Title | Priority Date |
|---|---|---|
| WO-2022056273-A1 | Lipid conjugates for the delivery of therapeutic agents | 2020-09-11 |
| EP-3889155-A1 | Biomimetic g-quartet compounds | 2020-03-31 |
| WO-2021198239-A1 | Biomimetic g-quartet compounds | 2020-03-31 |
| WO-2019242691-A1 | Paclitaxel-lipid-polysaccharide dual-type conjugate, preparation method therefor and use thereof | 2018-06-20 |
| EP-3812376-A1 | Paclitaxel-lipid-polysaccharide dual-type conjugate, preparation method therefor and use thereof | 2018-06-20 |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
