Inquiry Basket
![BD140 [for Albumin binding assay]](/upload/banner/product-default.jpg)
![BD140 [for Albumin binding assay]](https://resource.bocsci.com/structure/1201643-08-4.gif)
BD140 [for Albumin binding assay] | 1201643-08-4
| Catalog Number | F01-0255 |
| Category | BODIPY |
| Molecular Formula | C21H21BF2N2O |
| Molecular Weight | 366.22 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| F01-0255 | 100 mg | $819 | |
| F01-0255 | 1 g | $3599 |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Chemical Information |
|
|---|---|
| Synonyms | 2,2-difluoro-6-methyl-4-[(E)-2-(4-propoxyphenyl)ethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene; 4,4-Difluoro-1-methyl-3-(4-propoxystyryl)-4-bora-3a,4a-diaza-s-indacene; (E)-5,5-Difluoro-1-methyl-3-(4-propoxystyryl)-5H-5l4,6l4-dipyrrolo[1,2-c:2',1'-f][1,3,2]diazaborinine |
| Purity | >98.0% by GC |
| IUPAC Name | 2,2-difluoro-6-methyl-4-[(E)-2-(4-propoxyphenyl)ethenyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| Canonical SMILES | [B-]1(N2C(=CC(=C2C=C3[N+]1=CC=C3)C)C=CC4=CC=C(C=C4)OCCC)(F)F |
| InChI | InChI=1S/C21H21BF2N2O/c1-3-13-27-20-10-7-17(8-11-20)6-9-19-14-16(2)21-15-18-5-4-12-25(18)22(23,24)26(19)21/h4-12,14-15H,3,13H2,1-2H3/b9-6+ |
| InChI Key | NDQRWYKJLFZGBK-RMKNXTFCSA-N |
| Appearance | Solid |
| Melting Point | 155 °C |
- Product Specification
| Maximum Absorption Wavelength | 565(CH2Cl2) nm |
| Condition To Avoid | Light Sensitive |
| Signal | Warning |
| GHS Hazard Statements | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] |
| Precautionary Statement Codes | P264, P264+P265, P280, P302+P352, P305+P351+P338, P321, P332+P317, P337+P317, and P362+P364 (The corresponding statement to each P-code can be found at the GHS Classification page.) |
Computed Properties | |
|---|---|
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 366.1714998 g/mol |
| Monoisotopic Mass | 366.1714998 g/mol |
| Topological Polar Surface Area | 17.2Ų |
| Heavy Atom Count | 27 |
| Formal Charge | 0 |
| Complexity | 680 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
