Inquiry Basket
3-azidopropanoate-N-hydroxysuccinimide ester | 850180-76-6
| Catalog Number | R14-0324 |
| Category | Azides |
| Molecular Formula | C7H8N4O4 |
| Molecular Weight | 212.16 |
| Catalog Number | Size | Price | Quantity |
|---|---|---|---|
| R14-0324 | -- | $-- |
- Worldwide Delivery
- Quality Assurance
- 24/7 Customer Service
Product Introduction
3-azidopropanoate-N-hydroxysuccinimide ester is a small molecule reagent. As a versatile reactive reagent, it has a significant impact on bioconjugation and cross-linking applications. It is deeply embedded in the synthetic mechanism of drug delivery systems, effectively achieving precise targeted release of therapeutic drugs.
Chemical Information |
|
|---|---|
| Synonyms | 3-Azidopropanoic acid NHS ester;Propanoic acid, 3-azido-, 2,5-dioxo-1-pyrrolidinyl ester ; |
| Purity | ≥98% |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-azidopropanoate |
| Canonical SMILES | C1CC(=O)N(C1=O)OC(=O)CCN=[N+]=[N-] |
| InChI | InChI=1S/C7H8N4O4/c8-10-9-4-3-7(14)15-11-5(12)1-2-6(11)13/h1-4H2 |
| InChI Key | WATICTZQAVLEKN-UHFFFAOYSA-N |
| Solubility | DMSO, DCM, DMF |
| Appearance | Soild powder |
- Product Specification
| Storage | -20 °C |
Computed Properties | |
|---|---|
| XLogP3 | 0.1 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Exact Mass | 212.05455475 g/mol |
| Monoisotopic Mass | 212.05455475 g/mol |
| Topological Polar Surface Area | 78Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 331 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
Patents
| Publication Number | Title | Priority Date |
|---|---|---|
| WO-2020086311-A1 | Thiophosphorodichloridate reagents for chemoselective histidine bioconjugation | 2018-10-23 |
| US-2021230215-A1 | Thiophosphorodichloridate Reagents for Chemoselective Histidine Bioconjugation | 2018-10-23 |
| US-2016272669-A1 | Novel reagents for universal site-specific labeling and modifications of nucleic acids | 2015-03-17 |
| US-9856285-B2 | Reagents for universal site-specific labeling and modifications of nucleic acids | 2015-03-17 |
| US-10557853-B2 | Molecular sensor and methods of use thereof | 2012-12-31 |
Applications of Fluorescent Probes & Dyes
Get More Product Details?
